This compound is a potassium salt of a phosphate ester, commonly utilized as a laboratory reagent in chemical research and synthesis. Its structure features a phosphate group with two tert-butyl substituents and a potassium counterion, conferring specific solubility and reactivity properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 33494-80-3
(Z)-N-Ethyl-N-methyl-2-oxo-3-(phenyl((4-(piperidin-1-ylmethyl)phenyl)amino)methylene)indoline-6-carboxamide
research compound
1,2-Dihydroxybenzene-1-13c
Isotope-labeled research compound
Norleual
research compound
(2S)-2-[(2-Methylpropan-2-yl)oxycarbonylamino](1,2,3-13C3)propanoic acid
Isotopically labeled amino acid derivative
SZCKQRFZBSIRLK-UHFFFAOYSA-N
CC(C)(C)OP(=O)(O)OC(C)(C)C.[K]
—