N-Acetyl-L-isoleucine is a derivative of the amino acid isoleucine, where the amino group is acetylated. It is primarily used as a research compound in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3077-46-1
Aluminum, chloro[[2,2'-[(1S,2S)-1,2-cyclohexanediylbis[(nitrilo-kappaN)methylidyne]]bis[4,6-bis(1,1-dimethylethyl)phenolato-kappaO]](2-)]-, (SP-5-13)-
asymmetric synthesis catalyst
L-4-Hydroxyphenyl-3,5-d2-alanine
deuterium-labeled reference compound
Methyl (S)-3-(7-bromo-2-oxo-5-(pyridin-2-yl)-2,3-dihydro-1H-benzo[e][1,4]diazepin-3-yl)propanoate
research reagent
Trimethylsulfonium bromide
Research reagent
(2S,3S)-2-acetamido-3-methylpentanoic acid
JDTWZSUNGHMMJM-FSPLSTOPSA-N
CC[C@H](C)[C@@H](C(=O)O)NC(=O)C