L-4-Hydroxyphenyl-3,5-d2-alanine is a deuterium-labeled derivative of the amino acid L-tyrosine, specifically deuterated at the 3 and 5 positions of the phenyl ring. It is used as a reference compound in analytical research, particularly for mass spectrometry and metabolic studies where isotopic labeling aids quantification.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 30811-19-9
Methyl (S)-3-(7-bromo-2-oxo-5-(pyridin-2-yl)-2,3-dihydro-1H-benzo[e][1,4]diazepin-3-yl)propanoate
research reagent
Trimethylsulfonium bromide
Research reagent
Trans-Cinnamic-d7 acid
deuterated analytical standard
DSG-PEG 2000
PEGylated lipid reagent
D-tyrosine
Research amino acid reagent
DL-Tyrosine
amino acid dietary supplement
تيروسين
nutritional supplement and flavoring agent
L-Tyrosine D4
stable isotope labeled research compound
(2S)-2-amino-3-(3,5-dideuterio-4-hydroxyphenyl)propanoic acid
OUYCCCASQSFEME-ZQCIBQAJSA-N
[2H]C1=CC(=CC(=C1O)[2H])C[C@@H](C(=O)O)N