DOTA-GA(tBu)4 is a protected derivative of a DOTA-based chelating agent, featuring tert-butyl ester protecting groups. It serves as a precursor in the synthesis of chelating agents used in research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 306776-79-4
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research reagent
(R)-NODAGA-tris(t-Bu ester)
chelating agent intermediate for bioconjugation
2,4-di(tert-butoxy)pyrimidin-5-ylboronic acid hydrate
Boron-containing research compound
Cu-TMEDA catalyst
coordination chemistry catalyst
5-bromopyridine-2-carboxylic acid
Research chemical intermediate
N-Acetyl-L-isoleucine
research compound
Tri-tert-butyl 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetate
protected macrocyclic chelating agent
Cyclen
macrocyclic ligand for metal chelation
5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid
SUAUFMLRKFUOID-UHFFFAOYSA-N
CC(C)(C)OC(=O)CN1CCN(CCN(CCN(CC1)CC(=O)OC(C)(C)C)C(CCC(=O)O)C(=O)OC(C)(C)C)CC(=O)OC(C)(C)C