This compound is a deuterium-labeled research reagent, specifically a hexadeuterated derivative of a dithiol diol. Its primary significance lies in its use as an isotopically labeled compound for analytical and research applications, where the incorporation of deuterium enables tracing and quantification in mass spectrometry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 302912-05-6
L-Aspartic acid-2,3,3-d3
isotopically labeled research reagent
2-Methylalanine-d6
isotopically labeled research reagent
(13C)-Methane
isotopically labeled research reagent
Dimethylamine-15N hydrochloride
isotopically labeled research reagent
2-AMINO-N-(2-CHLORO-6-METHYLPHENYL)THIAZOLE-5-CARBOXAMIDE
research compound
(Z)-1-(2-((4-(((6-(methoxycarbonyl)-2-oxoindolin-3-ylidene)(phenyl)methyl)amino)phenyl)(methyl)amino)-2-oxoethyl)-4-methylpiperazine 1-oxide
research compound
Intedanib Piperazinyl-N4-oxide
N-oxide metabolite reference standard
2,6-DIHYDROXYBENZOIC ACID
MALDI matrix compound
1,1,2,3,4,4-hexadeuterio-2,3-dideuteriooxy-1,4-bis(deuteriosulfanyl)butane
VHJLVAABSRFDPM-BSSDICLPSA-N
[2H]C([2H])(C([2H])(C([2H])(C([2H])([2H])S[2H])O[2H])O[2H])S[2H]