This compound is a research reagent designed for conjugation studies, featuring a polyethylene glycol-based structure with multiple amide and ether linkages. Its large, flexible molecular architecture makes computational conformer generation impractical, highlighting its specialized nature for advanced bioconjugation applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2959475-51-3
9-(3-bromophenyl-2,4,5,6-d4)-9H-carbazole-1,2,3,4,5,6,7,8-d8
deuterated research compound
3,3'-diselane-1,2-diylbis(2-aminopropanoic acid)
biochemical research reagent
2-Fluoro-4-iodoaniline
research reagent
3,5-Dihydroxybenzyl alcohol
research compound
(2S)-2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]-N-[(2R)-1-[2-[2-[2-[2-[3-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethylamino]-1-oxo-3-sulfanylpropan-2-yl]-6-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanamide
HZIKEVLAEMPTBK-HYGNTPKVSA-N
COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)NCCCC[C@@H](C(=O)N[C@@H](CS)C(=O)NCCOCCOCCOCCOCCC(=O)N[C@@H](CS)C(=O)N)NC(=O)CNC(=O)CNC(=O)CN
—