This compound is a diselenide derivative of the amino acid cysteine, characterized by the presence of two amine and two carboxylic acid functional groups. It is primarily used as a research reagent in biochemical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 29621-88-3
2-Fluoro-4-iodoaniline
research reagent
3,5-Dihydroxybenzyl alcohol
research compound
Sodium 2-(trifluoromethyl)benzoate
organic synthesis intermediate
Methyl[(naphthalen-1-yl)methyl]nitrosoamine
N-nitrosamine reference standard
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]propanoic acid
JULROCUWKLNBSN-IMJSIDKUSA-N
C([C@@H](C(=O)O)N)[Se][Se]C[C@@H](C(=O)O)N