2,4,6-Trifluorobenzoic acid is a fluorinated aromatic carboxylic acid used as a research reagent. Its crystal structure has been reported in the scientific literature, highlighting its role in structural chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 28314-80-9
4-bromo-2,5-difluorobenzoic acid
research compound
5-Hydroxy-1-tetralone
reagent for glucose determination
2-Bromo-9,9-dimethylfluorene
Organic synthesis reagent
Sulfur trioxide-pyridine
sulfonation and sulfation reagent
2,4,6-trifluorobenzoic acid
SJZATRRXUILGHH-UHFFFAOYSA-N
C1=C(C=C(C(=C1F)C(=O)O)F)F