2-Fluorotoluene-alpha,alpha,alpha-D3 is a deuterated research compound, specifically a fluorinated toluene derivative where the methyl group is fully deuterated. It is primarily used as a labeled reagent in analytical and synthetic chemistry studies, particularly for tracing reaction pathways or as an internal standard in mass spectrometry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 25319-49-7
1-BROMO-2-(METHYL-D3)BENZENE
Deuterated research reagent
1,2-bis(trideuteriomethyl)benzene
isotopically labeled research compound
1,2-Octanedione, 1-(4-(phenylthio)phenyl)-, 2-(O-benzoyloxime)
research compound
Diethyl cyanomethylphosphonate
phosphonate reagent for synthesis
2-Fluorotoluene
pharmaceutical intermediate
1-fluoro-2-(trideuteriomethyl)benzene
MMZYCBHLNZVROM-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=CC=C1F