1-Bromo-2-(methyl-d3)benzene is a deuterated research reagent used in laboratory settings. Its structure features a bromine atom and a fully deuterated methyl group attached to an aromatic ring, making it valuable for isotopic labeling studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 25319-52-2
4-(2H3)methoxybenzoic acid
Deuterated research reagent
4-Bromoanisole-2,3,5,6-d4
Deuterated research reagent
P-TOLUIDINE-D9
Deuterated research reagent
2-Ethylhexanoic-d15 acid
Deuterated research reagent
1,2-bis(trideuteriomethyl)benzene
isotopically labeled research compound
1,2-Octanedione, 1-(4-(phenylthio)phenyl)-, 2-(O-benzoyloxime)
research compound
Diethyl cyanomethylphosphonate
phosphonate reagent for synthesis
Hexanedioic-2,2,3,3,4,4,5,5-d8 acid-1,6-d2
isotopic labeled analytical reference standard
1-bromo-2-(trideuteriomethyl)benzene
QSSXJPIWXQTSIX-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=CC=C1Br