Nitroso-L-arginine is a nitrosamine derivative of the amino acid arginine. It is primarily used as a reference standard for analytical testing and research into nitrosamine impurities.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2492451-27-9
N-Nitroso n-Methyl-3-phenylpropan-1-amine
nitrosamine reference standard
N-nitroso-desmethyl-orphenadrine
nitrosamine reference standard
N-Nitroso Betahistine
nitrosamine reference standard
Alverine Impurity 19
nitrosamine reference standard
2-Chloro-3,5-dinitrobenzoic acid
arylating agent
(2-bromophenyl)methanesulfonyl Chloride
research compound
4-Aminobenzamidine dihydrochloride
research compound
8-CHLORO-2-METHOXY-1,5-NAPHTHYRIDINE
research compound
(2S)-5-(diaminomethylideneamino)-2-(2-oxohydrazinyl)pentanoic acid
JJWNDJPMAQXKDS-BYPYZUCNSA-N
C(C[C@@H](C(=O)O)NN=O)CN=C(N)N