2-Chloro-3,5-dinitrobenzoic acid is a chemical compound used as an arylating agent in research and laboratory settings. It features a benzene ring substituted with chloro, dinitro, and carboxylic acid functional groups.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2497-91-8
(2-bromophenyl)methanesulfonyl Chloride
research compound
4-Aminobenzamidine dihydrochloride
research compound
8-CHLORO-2-METHOXY-1,5-NAPHTHYRIDINE
research compound
Pinacolborane
Research reagent for hydroboration
2-chloro-3,5-dinitrobenzoic acid
ADTKEYLCJYYHHH-UHFFFAOYSA-N
C1=C(C=C(C(=C1C(=O)O)Cl)[N+](=O)[O-])[N+](=O)[O-]