(10E,12Z)-10,12-Octadecadienoic acid is a conjugated linoleic acid isomer used primarily as an analytical reference standard in research. It is a fatty acid characterized by a specific configuration of conjugated double bonds and a carboxylic acid group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2420-56-6
Potassium N-Cocoyl Glycinate
Surfactant in personal care products
Palmitoleic acid
monounsaturated fatty acid
Nervonic acid
monounsaturated fatty acid
Oleic acid
textile processing and metal extraction
2-Amino-3,5-dibromopyrazine
Research compound for chemical synthesis
(S)-1-tert-Butyl 5-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate
research compound
2-Bromo-3-thiophenecarboxylic acid
research reagent
Nadide phosphate disodium
biochemical research reagent
(10E,12Z)-octadeca-10,12-dienoic acid
GKJZMAHZJGSBKD-NMMTYZSQSA-N
CCCCC/C=C\C=C\CCCCCCCCC(=O)O