This compound is a glutamic acid derivative featuring a tert-butyl ester protecting group on the side chain carboxyl. It is primarily used as a research reagent in peptide synthesis and biochemical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2419-56-9
Di-tert-butyl Glutamate Hydrochloride
Pharmaceutical intermediate for peptide synthesis
TERT-BUTYL (4S)-4-AMINO-4-CARBAMOYLBUTANOATE HYDROCHLORIDE
Peptide synthesis intermediate
Methyl 4-acetamido-5-chloro-2-hydroxybenzoate
pharmaceutical intermediate
(10E,12Z)-10,12-Octadecadienoic acid
analytical reference standard for CLA research
2-Amino-3,5-dibromopyrazine
Research compound for chemical synthesis
(S)-1-tert-Butyl 5-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate
research compound
(2S)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid
OIOAKXPMBIZAHL-LURJTMIESA-N
CC(C)(C)OC(=O)CC[C@@H](C(=O)O)N