2-Bromo-1-[4-(2,6-difluorophenoxy)phenyl]ethanone is a brominated difluorophenoxyphenyl ketone compound used primarily as a chemical intermediate in organic synthesis. Its structure features two aromatic rings, an ether linkage, and a halogenated ketone moiety, making it suitable for constructing more complex molecules in research and laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2410975-52-7
N-Biotinyl Dopamine
research compound for biotinylation studies
9-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)-3,6-bis(9-phenylcarbazol-3-yl)carbazole
organic semiconductor research compound
AST5902 mesylate
research compound for tyrosine kinase
Acalabrutinib Impurity 21
pharmaceutical impurity reference standard
2-bromo-1-[4-(2,6-difluorophenoxy)phenyl]ethanone
GEBMDWUJIRFTKK-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)OC2=CC=C(C=C2)C(=O)CBr)F
—