P-Toluidine-d3 (methyl-d3) is a deuterium-labeled version of p-toluidine, where the methyl group hydrogen atoms are replaced with deuterium. It is primarily used as a research reagent in studies requiring isotopic labeling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 23346-25-0
5-Bromoisophthalic acid
Building block for chemical synthesis
L-Prolinol
Research reagent for peptide synthesis
(R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine
Research compound
(1S,2R)-(+)-2-Amino-1,2-diphenylethanol
research compound
P-TOLUIDINE-D9
Deuterated research reagent
4-Toluidine-d7 (Major)
deuterated research standard
بارا-توليدين
Intermediate for dyes manufacture
4-(trideuteriomethyl)aniline
RZXMPPFPUUCRFN-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=C(C=C1)N