5-Bromoisophthalic acid is a brominated dicarboxylic acid used as a building block in chemical synthesis. It is commonly employed as a research reagent for the preparation of more complex organic compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 23351-91-9
L-Prolinol
Research reagent for peptide synthesis
(R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine
Research compound
(1S,2R)-(+)-2-Amino-1,2-diphenylethanol
research compound
Potassium allyltrifluoroborate
cross-coupling reagent
5-bromobenzene-1,3-dicarboxylic acid
JATKASGNRMGFSW-UHFFFAOYSA-N
C1=C(C=C(C=C1C(=O)O)Br)C(=O)O