This compound is a deuterated form of ethylene glycol, where all four hydrogen atoms on the carbon atoms are replaced with deuterium. It is primarily used as a deuterated solvent or reference standard in nuclear magnetic resonance (NMR) spectroscopy and other analytical applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2219-51-4
Calcium;dibromide;dihydrate
Industrial chemical
3,5-Bis(trifluoromethyl)benzamide
Chemical intermediate for pharmaceutical synthesis
2-Butanone, O,O',O''-(ethenylsilylidyne)trioxime
crosslinking agent for silicone polymers
Phenol, 2,2',2''-(1,3,5-triazine-2,4,6-triyl)tris[5-(hexyloxy)-6-methyl-
UV absorber for plastics
Ethane-1,2-diol;2-hydroxyacetic acid
polyethylene glycol diacid precursor
إيثيلين غليكول
antifreeze and polyester fiber raw material
(1,1,2,2-2H4)Ethane-1,2-(2H2)diol
deuterated NMR standard
1,1,2,2-tetradeuterioethane-1,2-diol
LYCAIKOWRPUZTN-LNLMKGTHSA-N
[2H]C([2H])(C([2H])([2H])O)O