This compound is a perdeuterated form of ethylene glycol, specifically labeled with deuterium atoms at all hydrogen positions. It is primarily used as a deuterated NMR standard in research laboratories for calibrating or referencing nuclear magnetic resonance experiments.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 15054-86-1
(2Z)-[(4S)-4-Phenyl-4,5-dihydro-1,3-oxazol-2-yl][(4S)-4-phenyl-1,3-oxazolidin-2-ylidene]acetonitrile
research compound
1,1,2,2,3,4,5,6,7,8-decadeuterioacenaphthylene
Deuterated analytical reference standard
5-hydroxypyridine-2-carboxylic acid
research compound
1,2-DICHLOROETHYLENE-D2
deuterated chemical research standard
1,2-Ethane-1,1,2,2-d4-diol
deuterated solvent or reference standard
Ethane-1,2-diol;2-hydroxyacetic acid
polyethylene glycol diacid precursor
إيثيلين غليكول
antifreeze and polyester fiber raw material
1,1,2,2-tetradeuterio-1,2-dideuteriooxyethane
LYCAIKOWRPUZTN-UFSLNRCZSA-N
[2H]C([2H])(C([2H])([2H])O[2H])O[2H]