Dimethyl sulfoxide-d6 is a deuterated form of dimethyl sulfoxide (DMSO), an organosulfur compound widely used as a polar aprotic solvent. Its primary significance lies in its role as a deuterated solvent for NMR spectroscopy, enabling clear analysis of organic compounds without solvent signal interference.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2206-27-1
Methyl Alcohol-d4
deuterated solvent for NMR spectroscopy
2,5,8,11,14,17,20,23,26,29,32,35-Dodecaoxaoctatriacontan-38-oic acid succinimidyl ester
PEG-based crosslinking reagent
2-(2-bromophenyl)naphthalene
research chemical
Naphthalene, 2-(4-chlorophenyl)-
research compound
3-BROMO-7-CHLORO-FURO[2,3-C]PYRIDINE
research compound
Dimethyl sulfoxide
Industrial solvent and reaction medium
trideuterio(trideuteriomethylsulfinyl)methane
IAZDPXIOMUYVGZ-WFGJKAKNSA-N
[2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]