3-Isopropoxybenzeneboronic acid is a boronic acid derivative used as a research compound. It features an aromatic ring, an ether functional group, and two hydroxyl groups capable of hydrogen bonding.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 216485-86-8
4-(7-methoxyquinolin-4-yl)-2-methylphenol
Toll-like receptor 8 antagonist
(2R,6R)-2,6-dimethylpiperazine
research compound
N-HEXANE-D14
Deuterated solvent for analytical chemistry
Succinic acid-d6
Deuterated internal standard for analytical chemistry
(3-propan-2-yloxyphenyl)boronic acid
UKZVUHVNTYDSOP-UHFFFAOYSA-N
B(C1=CC(=CC=C1)OC(C)C)(O)O
—