Succinic acid-d6 is a deuterated form of succinic acid where six hydrogen atoms are replaced by deuterium. It is primarily used as an internal standard in analytical chemistry, enabling accurate quantification through isotopic dilution methods.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 21668-90-6
Hexanedioic-2,2,3,3,4,4,5,5-d8 acid-1,6-d2
isotopic labeled analytical reference standard
1,2-Diaminobenzene (D4, 98%)
Deuterated internal standard for analytical chemistry
PMK glycidic acid
research compound for reference standard
1-bromo-3-(bromomethyl)-5-fluorobenzene
Research reagent
4-HYDROXY-N,N,2-TRIMETHYL-1H-BENZO[D]IMIDAZOLE-6-CARBOXAMIDE
Research compound
2-(cyclohexen-1-yl)ethynyl-triethyl-silane
organosilicon research compound
Dipotassium succinate trihydrate
food additive and buffering agent
Hypromellose acetate succinate
pharmaceutical excipient
dideuterio 2,2,3,3-tetradeuteriobutanedioate
KDYFGRWQOYBRFD-DTDGFSOZSA-N
[2H]C([2H])(C(=O)O[2H])C([2H])([2H])C(=O)O[2H]