This compound is a research reagent featuring a chloromethyl-substituted phenoxyethyl group attached to an azepane ring. It is primarily used as a building block in organic synthesis for the preparation of more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 212771-30-7
1-(2-(4-(chloromethyl)phenoxy)ethyl)azepane hydrochloride
pharmaceutical intermediate
Pyridine-2-carboximidamide hydrochloride
Research compound for chemical synthesis
S-Ethylisothiourea hydrobromide
Research compound for chemical synthesis
2-Nitro-1-phenylpropane
Research compound for chemical synthesis
2-Amino-3,5-dibromopyrazine
Research compound for chemical synthesis
(E)-methyl 4-(dimethylamino)but-2-enoate
research compound
2,3-Difluoro-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine
research compound for peptide synthesis
1-[2-[4-(chloromethyl)phenoxy]ethyl]azepane
FGCIQSBZGOVNLI-UHFFFAOYSA-N
C1CCCN(CC1)CCOC2=CC=C(C=C2)CCl
—