2-Nitro-1-phenylpropane is a research compound used as a reagent in chemical synthesis. Its structure consists of a nitro group attached to a phenylpropane backbone, and it is primarily employed in laboratory-scale reactions and material preparation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 17322-34-8
1-(2-(4-(chloromethyl)phenoxy)ethyl)azepane
Research compound for chemical synthesis
Pyridine-2-carboximidamide hydrochloride
Research compound for chemical synthesis
2-Amino-5-bromopyrazine
Research compound for chemical synthesis
S-Ethylisothiourea hydrobromide
Research compound for chemical synthesis
(2R,3R,4R,5R)-2-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-((tert-butyldimethylsilyl)oxy)-5-(5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite
Nucleotide phosphoramidite building block
2,6-dimethoxypyridin-4-amine
research compound
Methyl 1H-imidazole-2-carboxylate
Research reagent
(5S)-5-[(2R)-2-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one
Vitamin D receptor antagonist research tool
2-nitropropylbenzene
OQBJLKIDAPUHSY-UHFFFAOYSA-N
CC(CC1=CC=CC=C1)[N+](=O)[O-]