2,2'-Dithiodipyridine is a chemical compound consisting of two pyridine rings linked by a disulfide bond. It serves as an oxidizing agent in molecular biology research, commonly used to activate thiol groups or form disulfide bonds in biomolecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2127-03-9
1-(2-(4-(chloromethyl)phenoxy)ethyl)azepane
Research compound for chemical synthesis
(E)-methyl 4-(dimethylamino)but-2-enoate
research compound
2,3-Difluoro-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine
research compound for peptide synthesis
2-(pyridin-2-yldisulfanyl)pyridine
HAXFWIACAGNFHA-UHFFFAOYSA-N
C1=CC=NC(=C1)SSC2=CC=CC=N2