2-(3,4-Dimethoxyphenyl)-3-methylbutanenitrile is a chemical compound used as a pharmaceutical intermediate. It is specifically employed in the synthesis of verapamil, a calcium channel blocker.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 20850-49-1
Ethyl 2-(Trifluoromethyl)nicotinate
Pharmaceutical intermediate for drug synthesis
Ethyl (2S,5S)-5-[(benzyloxy)amino]piperidine-2-carboxylate; oxalic acid
Pharmaceutical intermediate
L-tert-Leucine
Peptide building block for drug intermediates
D-Fructopyranose diacetonide
pharmaceutical intermediate
2-(3,4-dimethoxyphenyl)-3-methylbutanenitrile
NFXAXMOAVPLEBH-UHFFFAOYSA-N
CC(C)C(C#N)C1=CC(=C(C=C1)OC)OC