D-Fructopyranose diacetonide is a chemical compound used as a pharmaceutical intermediate. It features a polycyclic structure with multiple ether groups and a single alcohol group, commonly employed in synthetic chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 20880-92-6
Finerenone metabolite M2
Pharmaceutical intermediate for finerenone
Ambroxol Cycloimine Impurity
Pharmaceutical impurity reference standard
Enzalutamide Impurity 56
Pharmaceutical impurity reference standard
3-methyl-5-phenoxy-1(3h)-isobenzofuranone
pharmaceutical intermediate
توبيرامات
active pharmaceutical ingredient
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol
PSSHGMIAIUYOJF-XBWDGYHZSA-N
CC1(O[C@@H]2CO[C@@]3([C@H]([C@@H]2O1)OC(O3)(C)C)CO)C