Sodium cholate hydrate is a bile salt research reagent consisting of the sodium salt of cholic acid in a hydrated form. It is primarily used in laboratory studies involving bile acid chemistry and related biochemical pathways.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 206986-87-0
SODIUM CHOLATE
bile salt pharmaceutical ingredient
Sodium glycocholate hydrate
bile acid glycine conjugate
Sodium glycocholate
bile salt for fat emulsification
Diethyl 3,3'-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5,5-diyl)dipropanoate
research compound
D-4-Methoxymandelic acid
research compound
3-Ethynylaniline hydrochloride
research chemical
Saikosaponin-C
phytochemical reference standard
Cholic Acid-d5
deuterated reference standard
sodium;(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate;hydrate
MUVVIYFKOVLQHL-RCVKHMDESA-M
C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C.O.[Na+]