This compound is a research reagent featuring a dioxane ring with multiple ester functional groups. It is primarily used as a chemical intermediate for laboratory-scale synthesis and investigation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2070015-38-0
Methyl 3-(5-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate
research compound
D-4-Methoxymandelic acid
research compound
3-Ethynylaniline hydrochloride
research chemical
Saikosaponin-C
phytochemical reference standard
Mesityl-d10 oxide
isotopically labeled research compound
Ethyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate
research compound
2,2,5-Trimethyl-1,3-dioxane-4,6-dione
Pharmaceutical intermediate
1,3-Dioxane-5-propanoic acid, 2,2-dimethyl-4,6-dioxo-, methyl ester
n.a
ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]propanoate
VBRYYLKXUUYJJE-UHFFFAOYSA-N
CCOC(=O)CCC1(C(=O)OC(OC1=O)(C)C)CCC(=O)OCC
—