This compound is a perfluorinated ether acid fluoride intermediate, characterized by a highly fluorinated ether backbone and an acyl fluoride group. It is primarily used in industrial chemical processes as a building block for specialized fluorinated materials.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2062-98-8
P-carborane
boron cluster compound precursor
4-Butylbenzoic acid
Building block for organic synthesis
2,5-Dicyanopyridine
chemical intermediate for synthesis
2-Bromo-2-methylpropionyl bromide
Fine and large scale chemical synthesis
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl fluoride
BCLQALQSEBVVAD-UHFFFAOYSA-N
C(=O)(C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F)F