p-Carborane is a boron cluster compound characterized by a cage-like molecular structure. It serves as a precursor in the synthesis of other boron-rich compounds for research and industrial applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 20644-12-6
1,7-Dicarbadodecaborane(12)
boron cluster chemistry building block
4-Butylbenzoic acid
Building block for organic synthesis
2,5-Dicyanopyridine
chemical intermediate for synthesis
2-Bromo-2-methylpropionyl bromide
Fine and large scale chemical synthesis
Nickel bis(trifluoromethylsulfonyl)imide
Electrolyte material for batteries
CFNUZRMHHJZBOM-UHFFFAOYSA-N
[B]1[B][B][B]C2[B][B]C([B]2)[B][B][B]1