This compound is a pharmaceutical intermediate used in the synthesis of bilastine, a second-generation antihistamine. It features a sulfonate ester group and an oxazole ring, contributing to its role in pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 202189-76-2
3-CHLORO-4-(3-FLUOROBENZYLOXY)ANILINE
pharmaceutical intermediate
L-Isocitric acid
pharmaceutical intermediate
4-Nitrothalidomide, (S)-
pharmaceutical impurity standard
C-6-Cl-ddG
Pharmaceutical intermediate for carbocyclic nucleosides
2-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]ethyl 4-methylbenzenesulfonate
BGUOPDZOVDIWLE-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)OCCC2=CC=C(C=C2)C(C)(C)C3=NC(CO3)(C)C