This compound is a pharmaceutical intermediate featuring a chloro-substituted aniline core with a fluorobenzyl ether side chain. It is primarily used in the synthesis of more complex active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 202197-26-0
L-Isocitric acid
pharmaceutical intermediate
4-Nitrothalidomide, (S)-
pharmaceutical impurity standard
C-6-Cl-ddG
Pharmaceutical intermediate for carbocyclic nucleosides
6,7-Dimethoxy-3,4-dihydroisoquinoline hydrochloride
Pharmaceutical intermediate
3-chloro-4-[(3-fluorophenyl)methoxy]aniline
AYPFEYDGZDPAPE-UHFFFAOYSA-N
C1=CC(=CC(=C1)F)COC2=C(C=C(C=C2)N)Cl