This compound is an organic molecule used as a pharmaceutical intermediate. It features a complex structure with multiple amide and aromatic groups, indicating its role as a building block in drug manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 200575-15-1
H-D-Glu-OtBu HCl
peptide synthesis building block
N-Fmoc-N'-trityl-D-glutamine
Peptide synthesis building block
Eldecalcitol interMediates
Eldecalcitol synthetic intermediate
(S)-tert-Butyl oxirane-2-carboxylate
chiral building block for synthesis
4-[[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylbenzoyl]amino]-1-methyl-3-propylpyrazole-5-carboxamide
IFFGTBBYPRZJLD-UHFFFAOYSA-N
CCCC1=NN(C(=C1NC(=O)C2=C(C=CC(=C2)S(=O)(=O)N3CCN(CC3)C)OCC)C(=O)N)C