This compound is a synthetic intermediate specifically used in the production of eldecalcitol, a vitamin D analog. It features a cyclohexylidene ethanol core with multiple tert-butyl(dimethyl)silyl protecting groups, which are common in multi-step pharmaceutical synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 200636-42-6
(S)-tert-Butyl oxirane-2-carboxylate
chiral building block for synthesis
Ethyl 3-(2-methoxyphenyl)-2-oxopropanoate
Pharmaceutical intermediate for synthesis
1-(2-Chloroethyl)piperidine hydrochloride
Pharmaceutical intermediate
2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol
Pharmaceutical intermediate for tolterodine synthesis
Cyclohexane, 1,2-bis(methylene)-
chemical intermediate
(Z)-2-((3S,5R)-3,5-bis((tert-butyldiMethylsilyl)oxy)-2-Methylenecyclohexylidene)ethanol
n.a
Elastase
Proteolytic enzyme for research
(3Z)-3-(3-methylbut-2-enylidene)-4-methylidenecyclohexan-1-ol
Reactive dye
(2Z)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-methylidenecyclohexylidene]ethanol
LKDMRCVDAOOZGO-JZEAMISTSA-N
CC(C)(C)[Si](C)(C)OCCCO[C@@H]1[C@@H](C/C(=C/CO)/C(=C)[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C