This compound is a steroid heterocycle intermediate with a complex polycyclic structure containing an alcohol, an ether, and an aromatic heterocycle. It is primarily used in pharmaceutical manufacturing as a building block for the synthesis of steroidal compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 20051-76-7
2-MERCAPTO-N-METHYLBENZAMIDE
Pharmaceutical intermediate synthesis
4-[[2-ETHOXY-5-[(4-METHYL-1-PIPERAZINYL)SULFONYL]BENZOYL]AMINO]-1-METHYL-3-PROPYL-1H-PYRAZOLE-5-CARBOXAMIDE
pharmaceutical intermediate
H-D-Glu-OtBu HCl
peptide synthesis building block
N-Fmoc-N'-trityl-D-glutamine
Peptide synthesis building block
(1S,4S,5S,8S,9S,12S,13R,20S)-9,13-dimethyl-18,21-dioxa-17-azahexacyclo[11.8.0.01,20.04,12.05,9.015,19]henicosa-15(19),16-dien-8-ol
SFLURVMKFVJRKJ-CXANFOAXSA-N
C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CC[C@]45[C@@]3(CC6=C([C@H]4O5)ON=C6)C