Adenosine-(1)N N1-oxide is a nitrogen-15 labeled research compound derived from adenosine, featuring an N-oxide modification at the N1 position of the purine ring. It is primarily used as a reference standard or tracer in analytical and biochemical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 197227-85-3
1-Methyladenosine
research compound
6-Nitroindoline
Caged neurotransmitter precursor research compound
Z-Thr-OH
research compound
3-O-(2-methoxyethyl) 5-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrosophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Nitrosamine impurity reference standard
2-Methyl-4-nitrobenzoic acid
research compound
(2R,3R,4S,5R)-2-(6-(15N)azanylidene-1-hydroxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
QHFLZHVITNUFMV-ZGUONDJVSA-N
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=CN(C2=[15NH])O