1-Methyladenosine is a methylated nucleoside derived from adenosine, where a methyl group is attached to the nitrogen at position 1 of the adenine base. It is a naturally occurring human metabolite and is commonly used as a research compound in biochemical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 15763-06-1
Adenosine-(1)N N1-Oxide
research compound
3,4-Difluoro-2-methylbenzoic acid
research compound
Progesterone-2,2,4,6,6,17alpha,21,21,21-d9
deuterated internal standard for mass spectrometry
Mal-C6-|A-Amanitin
Research compound for targeted delivery
(2,2'-Bipyridyl)bis[2-(4-fluorophenyl)pyridine]iridium(III) hexafluorophosphate
organometallic research compound
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-imino-1-methylpurin-9-yl)oxolane-3,4-diol
GFYLSDSUCHVORB-IOSLPCCCSA-N
CN1C=NC2=C(C1=N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O