This compound is a research reagent featuring a triazine core with morpholine and difluoromethyl-substituted pyridine moieties. Its significance lies in its use as a laboratory tool for biochemical or pharmacological studies, based on its heterocyclic structure.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1927857-61-1
2-Oxo-3-(3-(trifluoromethoxy)phenyl)propanoic acid
research compound
Borane (B2H6)
research reagent for chemical synthesis
5-Fluoro-2-[4-(4-nitrophenyl)-1-piperazinyl]pyrimidine
research compound
Methyl 1H-indazole-4-carboxylate
research compound
4-(difluoromethyl)-5-[4-[(3S)-3-methylmorpholin-4-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]pyridin-2-amine
SYKBZXMKAPICSO-NSHDSACASA-N
C[C@H]1COCCN1C2=NC(=NC(=N2)N3CCOCC3)C4=CN=C(C=C4C(F)F)N