This compound is a research compound containing an aromatic ring, an ether group, and a carboxylic acid moiety. It is primarily utilized in laboratory settings for chemical synthesis and investigation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1928104-68-0
Borane (B2H6)
research reagent for chemical synthesis
5-Fluoro-2-[4-(4-nitrophenyl)-1-piperazinyl]pyrimidine
research compound
Methyl 1H-indazole-4-carboxylate
research compound
7-HYDROXYNAPHTHALENE-1-CARBONITRILE
research compound
2-oxo-3-[3-(trifluoromethoxy)phenyl]propanoic acid
KBHPHNSKEICFOP-UHFFFAOYSA-N
C1=CC(=CC(=C1)OC(F)(F)F)CC(=O)C(=O)O
—