4-Chloroaniline-2,3,5,6-d4 is a deuterated analytical reference standard used primarily in quantitative mass spectrometry and internal standard methods. Its isotopic labeling allows for accurate quantification of 4-chloroaniline in complex matrices.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 191656-33-4
Lawesson's reagent
Thionating agent for carbonyls
2-Thiopheneacetic acid
research compound
2-methylthiophene-3-carboxylic acid
research compound
Aristeromycin
nucleoside analogue research compound
4-CHLOROANILINE
Chemical intermediate for dyes
4-chloro-2,3,5,6-tetradeuterioaniline
QSNSCYSYFYORTR-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1N)[2H])[2H])Cl)[2H]