Isoleucine methyl ester hydrochloride is a chemical compound used as a research reagent, typically in laboratory settings for synthetic and biochemical studies. It is the hydrochloride salt form of the methyl ester derivative of the amino acid isoleucine.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 18598-74-8
3-chlorophenylzinc iodide
organometallic reagent for cross-coupling
Fmoc-Ala-Pro-OH
research compound for peptide synthesis
Fmoc-Val-Ser(Psime,Mepro)-OH
building block for peptide synthesis
Fmoc-PNA-C(Bhoc)-OH
Peptide nucleic acid building block
methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride
GGTBEWGOPAFTTH-GEMLJDPKSA-N
CC[C@H](C)[C@@H](C(=O)OC)N.Cl