10-Phenyldecanoic acid is a long-chain fatty acid derivative featuring a phenyl group attached to the terminal carbon. It is primarily used as an intermediate in pharmaceutical research and manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 18017-73-7
11-Phenylundecanoic acid
Research compound for lipid studies
12-Phenyllauric acid
research compound
9-Phenylnonanoic acid
medium-chain fatty acid research compound
4-PHENYLBUTYRIC ACID
Histone deacetylase inhibitor
3-(Trifluoromethoxy)phenylboronic acid (contains varying amounts of Anhydride)
Pharmaceutical research intermediate
4,5-DIHYDRO-5-METHYL-3,4-DIPHENYL-5-ISOXAZOLOL
Pharmaceutical research intermediate
Ethyl 5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylate
Pharmaceutical research intermediate
(R)-2'-Oxo-1',2',5,7-tetrahydrospiro[cyclopenta[b]pyridine-6,3'-pyrrolo[2,3-b]pyridine]-3-carboxylic acid
Pharmaceutical research intermediate
10-phenyldecanoic acid
IISIYJPTBDSIFM-UHFFFAOYSA-N
C1=CC=C(C=C1)CCCCCCCCCC(=O)O