This compound is a boronic acid derivative featuring a trifluoromethoxy substituent on the aromatic ring, commonly used as an intermediate in pharmaceutical research. It is typically supplied with varying amounts of anhydride, reflecting its utility in synthetic chemistry applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 179113-90-7
10-Phenyldecanoic acid
Pharmaceutical research intermediate
4,5-DIHYDRO-5-METHYL-3,4-DIPHENYL-5-ISOXAZOLOL
Pharmaceutical research intermediate
Ethyl 5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylate
Pharmaceutical research intermediate
(R)-2'-Oxo-1',2',5,7-tetrahydrospiro[cyclopenta[b]pyridine-6,3'-pyrrolo[2,3-b]pyridine]-3-carboxylic acid
Pharmaceutical research intermediate
1-Chloro-4-methoxybutane
pharmaceutical intermediate
4-[5-[4-(Pentyloxy)phenyl]-3-isoxazolyl]benzoic acid
Pharmaceutical intermediate
4-Bromo-2-fluoro-benzoic acid methyl ester
Pharmaceutical intermediate
3-aminoazepan-2-one
pharmaceutical intermediate
[3-(trifluoromethoxy)phenyl]boronic acid
UWDFWVLAHRQSKK-UHFFFAOYSA-N
B(C1=CC(=CC=C1)OC(F)(F)F)(O)O
—