6-Chloro-2-methyl-5-nitro-2H-indazole is a chemical compound used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. It features a nitro-substituted indazole core with a chlorine atom, contributing to its role in medicinal chemistry research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1801267-04-8
10-Phenyldecanoic acid
Pharmaceutical research intermediate
(Des-Thr7)-Glucagon Trifluoroacetate
Pharmaceutical intermediate
5-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)-3-methyl-1,3-benzoxazol-2(3H)-one
Pharmaceutical intermediate for drug synthesis
Methyl 2-fluoro-4-(1-methoxy-2-methyl-1-oxopropan-2-ylamino)benzoate
Pharmaceutical intermediate
6-chloro-2-methyl-5-nitroindazole
CHLANRNBFOWJBG-UHFFFAOYSA-N
CN1C=C2C=C(C(=CC2=N1)Cl)[N+](=O)[O-]