5-Methoxy-2-nitro-4-(trifluoromethyl)benzene acetonitrile is a chemical compound with the structure of a nitrile-bearing aromatic ring, characterized by the presence of methoxy, nitro, and trifluoromethyl substituents. It is used primarily as a pharmaceutical intermediate in the synthesis of various medicinal compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 178896-77-0
2,4-Difluoro-3-methoxybenzoic acid
Pharmaceutical intermediate
L-Aspartic acid, bis(1,1-dimethylethyl) ester, hydrochloride
pharmaceutical intermediate for peptide synthesis
3-(Trifluoromethoxy)phenylboronic acid (contains varying amounts of Anhydride)
Pharmaceutical research intermediate
1-Chloro-4-methoxybutane
pharmaceutical intermediate
2-[5-methoxy-2-nitro-4-(trifluoromethyl)phenyl]acetonitrile
IANAREFPKLOIAF-UHFFFAOYSA-N
COC1=C(C=C(C(=C1)CC#N)[N+](=O)[O-])C(F)(F)F
—