N-Carbobenzoxy-D-phenylglycine (Cbz-D-Phg-OH) is a protected amino acid derivative used in peptide synthesis. Its structure features a benzyloxycarbonyl (Cbz) protecting group on the amino group, enabling selective incorporation of D-phenylglycine into peptide chains.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 17609-52-8
(2S)-2-(9H-Fuoren-9-ylmethoxycarbonylamino)-6-((1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene)amino)hexanoic acid
Peptide synthesis protected amino acid
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
N-(Benzoxycarbonyl)-O-(tert-butyl)-L-serine
Peptide synthesis protected amino acid
5-Bromosalicylaldehyde
Pharmaceutical intermediate
3-hydrazinylbenzonitrile
Pharmaceutical intermediate
Amisulpride EP impurity C
Pharmaceutical impurity reference standard
3-(2-Bromoacetyl)pyridine hydrobromide
pharmaceutical intermediate
(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid
RLDJWBVOZVJJOS-CQSZACIVSA-N
C1=CC=C(C=C1)COC(=O)N[C@H](C2=CC=CC=C2)C(=O)O