N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester, also known as Cbz-Tyr-OMe, is a protected amino acid derivative used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group on the amino function and a methyl ester on the carboxyl group, with a free phenolic hydroxyl group on the tyrosine side chain.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13512-31-7
N-Benzyloxycarbonyl-L-tyrosine
Peptide synthesis protecting group reagent
Z-TYR(TBU)-OME
Protected amino acid intermediate
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
N-(Benzoxycarbonyl)-O-(tert-butyl)-L-serine
Peptide synthesis protected amino acid
(R)-(((Phenylmethoxy)carbonyl)amino)phenylacetic acid
Peptide synthesis protected amino acid
(2S)-2-(9H-Fuoren-9-ylmethoxycarbonylamino)-6-((1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene)amino)hexanoic acid
Peptide synthesis protected amino acid
(1S)-1-(3-chlorophenyl)ethan-1-ol
Chiral building block for pharmaceuticals
3-(chloromethyl)-1-methyl-1H-1,2,4-triazole hydrochloride
pharmaceutical intermediate
methyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate
SLLMDHBKALJDBW-INIZCTEOSA-N
COC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)OCC2=CC=CC=C2