2-Amino-4-bromo-3,5-difluorobenzoic acid is a benzoic acid derivative containing amino, bromo, and difluoro substituents. It is primarily used as a research reagent in laboratory and chemical supply contexts.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1698027-86-9
Ethyl thiooxamate
research chemical
4-methyl-2-(propan-2-yl)pyridin-3-amine
research compound
Tacrolimus Impurity 9
pharmaceutical reference standard
(4S)-4-(propan-2-yl)-1,3-oxazolidin-2-one
Chiral amino alcohol derivative
2-amino-4-bromo-3,5-difluorobenzoic acid
HMEMIUSIGMVLLA-UHFFFAOYSA-N
C1=C(C(=C(C(=C1F)Br)F)N)C(=O)O
—