Tacrolimus Impurity 9 is a research reagent used as a pharmaceutical reference standard in analytical testing. It is a structurally characterized compound with a macrocyclic lactone backbone bearing multiple hydroxyl, ether, and ester functional groups, typically employed for quality control purposes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1700657-83-5
7-Chloro-5-phenyl-1H-1,4-benzodiazepine-2,3-dione
pharmaceutical reference standard
Albendazole EP Impurity H
pharmaceutical reference standard
6-Hydroxy-5-methoxypyrimidin-4(3H)-one
pharmaceutical reference standard
Norquetiapine
pharmaceutical reference standard
(4S)-4-(propan-2-yl)-1,3-oxazolidin-2-one
Chiral amino alcohol derivative
(4S)-4-(2-methylpropyl)-1,3-oxazolidin-2-one
research compound
B-(4-(3-Pyridinyl)phenyl)boronic acid
Research chemical for organic synthesis
4-Amino-3-ethylbenzonitrile
research compound
(4R,6S,7R,8S,10S,12E,14R,17S,18R,19S,22S)-3,7,17-trihydroxy-19-[(E)-1-[(1R,3R,4R)-4-hydroxy-3-methoxycyclohexyl]prop-1-en-2-yl]-6,8-dimethoxy-4,10,12,18-tetramethyl-2,15,21-trioxo-14-prop-2-enyl-20-oxa-1-azabicyclo[20.4.0]hexacos-12-ene-3-carboxylic acid
UJYIGARKMOMKSG-ONCIHNGKSA-N
C[C@@H]1C[C@@H]([C@H]([C@H](C[C@H](C(C(=O)N2CCCC[C@H]2C(=O)O[C@@H]([C@@H]([C@H](CC(=O)[C@@H](/C=C(/C1)\C)CC=C)O)C)/C(=C/[C@@H]3CC[C@H]([C@@H](C3)OC)O)/C)(C(=O)O)O)C)OC)O)OC